C18H21N5S2 — CID 133391291
12-[4-(4,5-dimethyl-1,3-thiazol-2-yl)piperazin-1-yl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene (PubChem CID 133391291) has the molecular formula C18H21N5S2 and a molecular weight of 371.54 g/mol. Its IUPAC name is 12-[4-(4,5-dimethyl-1,3-thiazol-2-yl)piperazin-1-yl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene.
| Compound Name | 12-[4-(4,5-dimethyl-1,3-thiazol-2-yl)piperazin-1-yl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene |
|---|---|
| PubChem CID | 133391291 |
| Molecular Formula | C18H21N5S2 |
| Molecular Weight | 371.54 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 12-[4-(4,5-dimethyl-1,3-thiazol-2-yl)piperazin-1-yl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene |
| SMILES | Cc1nc(N2CCN(c3ncnc4sc5c(c34)CCC5)CC2)sc1C |
| InChI | InChI=1S/C18H21N5S2/c1-11-12(2)24-18(21-11)23-8-6-22(7-9-23)16-15-13-4-3-5-14(13)25-17(15)20-10-19-16/h10H,3-9H2,1-2H3 |
| InChIKey | XEIQWRJZYRCOMQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.54 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |