C16H19F3N4S — CID 51286391
4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine (PubChem CID 51286391) has the molecular formula C16H19F3N4S and a molecular weight of 356.42 g/mol. Its IUPAC name is 4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine.
| Compound Name | 4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 51286391 |
| Molecular Formula | C16H19F3N4S |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine |
| SMILES | FC(F)(F)CN1CCN(c2ncnc3sc4c(c23)CCCC4)CC1 |
| InChI | InChI=1S/C16H19F3N4S/c17-16(18,19)9-22-5-7-23(8-6-22)14-13-11-3-1-2-4-12(11)24-15(13)21-10-20-14/h10H,1-9H2 |
| InChIKey | AULCOHVTQWTYNB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |