C17H25N5O2S2 — CID 17422043
N,N-diethyl-4-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)piperazine-1-sulfonamide (PubChem CID 17422043) has the molecular formula C17H25N5O2S2 and a molecular weight of 395.55 g/mol. Its IUPAC name is N,N-diethyl-4-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)piperazine-1-sulfonamide.
| Compound Name | N,N-diethyl-4-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 17422043 |
| Molecular Formula | C17H25N5O2S2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | N,N-diethyl-4-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)piperazine-1-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCN(c2ncnc3sc4c(c23)CCC4)CC1 |
| InChI | InChI=1S/C17H25N5O2S2/c1-3-21(4-2)26(23,24)22-10-8-20(9-11-22)16-15-13-6-5-7-14(13)25-17(15)19-12-18-16/h12H,3-11H2,1-2H3 |
| InChIKey | WROLVNUCSFQTTH-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |