C21H24N4OS — CID 78898509
12-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene (PubChem CID 78898509) has the molecular formula C21H24N4OS and a molecular weight of 380.52 g/mol. Its IUPAC name is 12-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene.
| Compound Name | 12-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene |
|---|---|
| PubChem CID | 78898509 |
| Molecular Formula | C21H24N4OS |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 12-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene |
| SMILES | COc1ccc(N2CCCN(c3ncnc4sc5c(c34)CCC5)CC2)cc1 |
| InChI | InChI=1S/C21H24N4OS/c1-26-16-8-6-15(7-9-16)24-10-3-11-25(13-12-24)20-19-17-4-2-5-18(17)27-21(19)23-14-22-20/h6-9,14H,2-5,10-13H2,1H3 |
| InChIKey | ACWQBUGPDWVULU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|