C19H24N6OS — CID 133281408
3-methyl-5-[1-[4-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]ethyl]-1,2,4-oxadiazole (PubChem CID 133281408) has the molecular formula C19H24N6OS and a molecular weight of 384.51 g/mol. Its IUPAC name is 3-methyl-5-[1-[4-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]ethyl]-1,2,4-oxadiazole.
| Compound Name | 3-methyl-5-[1-[4-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]ethyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 133281408 |
| Molecular Formula | C19H24N6OS |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 3-methyl-5-[1-[4-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]ethyl]-1,2,4-oxadiazole |
| SMILES | Cc1noc(C(C)N2CCN(c3ncnc4sc5c(c34)CCCC5)CC2)n1 |
| InChI | InChI=1S/C19H24N6OS/c1-12(18-22-13(2)23-26-18)24-7-9-25(10-8-24)17-16-14-5-3-4-6-15(14)27-19(16)21-11-20-17/h11-12H,3-10H2,1-2H3 |
| InChIKey | CSFNOAPDEPELBC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 71.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |