C17H18N4OS — CID 154575945
2-[4-(pyrazin-2-yloxymethyl)piperidin-1-yl]-1,3-benzothiazole (PubChem CID 154575945) has the molecular formula C17H18N4OS and a molecular weight of 326.42 g/mol. Its IUPAC name is 2-[4-(pyrazin-2-yloxymethyl)piperidin-1-yl]-1,3-benzothiazole.
| Compound Name | 2-[4-(pyrazin-2-yloxymethyl)piperidin-1-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 154575945 |
| Molecular Formula | C17H18N4OS |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 2-[4-(pyrazin-2-yloxymethyl)piperidin-1-yl]-1,3-benzothiazole |
| SMILES | c1ccc2sc(N3CCC(COc4cnccn4)CC3)nc2c1 |
| InChI | InChI=1S/C17H18N4OS/c1-2-4-15-14(3-1)20-17(23-15)21-9-5-13(6-10-21)12-22-16-11-18-7-8-19-16/h1-4,7-8,11,13H,5-6,9-10,12H2 |
| InChIKey | AUEIALFOKAEGMM-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |