C18H19N5O — CID 163353005
2-[3-(pyrazin-2-yloxymethyl)piperidin-1-yl]quinoxaline (PubChem CID 163353005) has the molecular formula C18H19N5O and a molecular weight of 321.38 g/mol. Its IUPAC name is 2-[3-(pyrazin-2-yloxymethyl)piperidin-1-yl]quinoxaline.
| Compound Name | 2-[3-(pyrazin-2-yloxymethyl)piperidin-1-yl]quinoxaline |
|---|---|
| PubChem CID | 163353005 |
| Molecular Formula | C18H19N5O |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 2-[3-(pyrazin-2-yloxymethyl)piperidin-1-yl]quinoxaline |
| SMILES | c1ccc2nc(N3CCCC(COc4cnccn4)C3)cnc2c1 |
| InChI | InChI=1S/C18H19N5O/c1-2-6-16-15(5-1)21-10-17(22-16)23-9-3-4-14(12-23)13-24-18-11-19-7-8-20-18/h1-2,5-8,10-11,14H,3-4,9,12-13H2 |
| InChIKey | AVBQHQXFZWUUSJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 64.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |