C16H21N5O3 — CID 163355020
4,6-dimethoxy-2-[3-(pyrazin-2-yloxymethyl)piperidin-1-yl]pyrimidine (PubChem CID 163355020) has the molecular formula C16H21N5O3 and a molecular weight of 331.38 g/mol. Its IUPAC name is 4,6-dimethoxy-2-[3-(pyrazin-2-yloxymethyl)piperidin-1-yl]pyrimidine.
| Compound Name | 4,6-dimethoxy-2-[3-(pyrazin-2-yloxymethyl)piperidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 163355020 |
| Molecular Formula | C16H21N5O3 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 4,6-dimethoxy-2-[3-(pyrazin-2-yloxymethyl)piperidin-1-yl]pyrimidine |
| SMILES | COc1cc(OC)nc(N2CCCC(COc3cnccn3)C2)n1 |
| InChI | InChI=1S/C16H21N5O3/c1-22-13-8-14(23-2)20-16(19-13)21-7-3-4-12(10-21)11-24-15-9-17-5-6-18-15/h5-6,8-9,12H,3-4,7,10-11H2,1-2H3 |
| InChIKey | GRKUPFJZZHLPNH-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 82.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |