C18H22FN3O2 — CID 163356836
2-[[1-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-3-yl]methoxy]pyrazine (PubChem CID 163356836) has the molecular formula C18H22FN3O2 and a molecular weight of 331.39 g/mol. Its IUPAC name is 2-[[1-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-3-yl]methoxy]pyrazine.
| Compound Name | 2-[[1-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-3-yl]methoxy]pyrazine |
|---|---|
| PubChem CID | 163356836 |
| Molecular Formula | C18H22FN3O2 |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 2-[[1-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-3-yl]methoxy]pyrazine |
| SMILES | COc1ccc(CN2CCCC(COc3cnccn3)C2)cc1F |
| InChI | InChI=1S/C18H22FN3O2/c1-23-17-5-4-14(9-16(17)19)11-22-8-2-3-15(12-22)13-24-18-10-20-6-7-21-18/h4-7,9-10,15H,2-3,8,11-13H2,1H3 |
| InChIKey | NLVQUYIKXAHUBO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |