C16H17F2N3 — CID 95829511
2-[(3S)-1-[(3,4-difluorophenyl)methyl]piperidin-3-yl]pyrazine (PubChem CID 95829511) has the molecular formula C16H17F2N3 and a molecular weight of 289.33 g/mol. Its IUPAC name is 2-[(3S)-1-[(3,4-difluorophenyl)methyl]piperidin-3-yl]pyrazine.
| Compound Name | 2-[(3S)-1-[(3,4-difluorophenyl)methyl]piperidin-3-yl]pyrazine |
|---|---|
| PubChem CID | 95829511 |
| Molecular Formula | C16H17F2N3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 2-[(3S)-1-[(3,4-difluorophenyl)methyl]piperidin-3-yl]pyrazine |
| SMILES | Fc1ccc(CN2CCC[C@H](c3cnccn3)C2)cc1F |
| InChI | InChI=1S/C16H17F2N3/c17-14-4-3-12(8-15(14)18)10-21-7-1-2-13(11-21)16-9-19-5-6-20-16/h3-6,8-9,13H,1-2,7,10-11H2/t13-/m0/s1 |
| InChIKey | UQJPUJQECLTKLU-ZDUSSCGKSA-N |
| XLogP | 3.13 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |