C17H19F2N3O — CID 154829858
2-[[1-[(3,5-difluorophenyl)methyl]piperidin-4-yl]methoxy]pyrazine (PubChem CID 154829858) has the molecular formula C17H19F2N3O and a molecular weight of 319.35 g/mol. Its IUPAC name is 2-[[1-[(3,5-difluorophenyl)methyl]piperidin-4-yl]methoxy]pyrazine.
| Compound Name | 2-[[1-[(3,5-difluorophenyl)methyl]piperidin-4-yl]methoxy]pyrazine |
|---|---|
| PubChem CID | 154829858 |
| Molecular Formula | C17H19F2N3O |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 2-[[1-[(3,5-difluorophenyl)methyl]piperidin-4-yl]methoxy]pyrazine |
| SMILES | Fc1cc(F)cc(CN2CCC(COc3cnccn3)CC2)c1 |
| InChI | InChI=1S/C17H19F2N3O/c18-15-7-14(8-16(19)9-15)11-22-5-1-13(2-6-22)12-23-17-10-20-3-4-21-17/h3-4,7-10,13H,1-2,5-6,11-12H2 |
| InChIKey | KOIUKFWHDPYJAY-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |