C17H19ClFN3O — CID 154829932
2-[[1-[(2-chloro-6-fluorophenyl)methyl]piperidin-4-yl]methoxy]pyrazine (PubChem CID 154829932) has the molecular formula C17H19ClFN3O and a molecular weight of 335.81 g/mol. Its IUPAC name is 2-[[1-[(2-chloro-6-fluorophenyl)methyl]piperidin-4-yl]methoxy]pyrazine.
| Compound Name | 2-[[1-[(2-chloro-6-fluorophenyl)methyl]piperidin-4-yl]methoxy]pyrazine |
|---|---|
| PubChem CID | 154829932 |
| Molecular Formula | C17H19ClFN3O |
| Molecular Weight | 335.81 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 2-[[1-[(2-chloro-6-fluorophenyl)methyl]piperidin-4-yl]methoxy]pyrazine |
| SMILES | Fc1cccc(Cl)c1CN1CCC(COc2cnccn2)CC1 |
| InChI | InChI=1S/C17H19ClFN3O/c18-15-2-1-3-16(19)14(15)11-22-8-4-13(5-9-22)12-23-17-10-20-6-7-21-17/h1-3,6-7,10,13H,4-5,8-9,11-12H2 |
| InChIKey | INGUDNBAFWNAIW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.81 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |