C16H22ClFN2O — CID 171691361
4-[1-[(2-chloro-6-fluorophenyl)methyl]piperidin-4-yl]morpholine (PubChem CID 171691361) has the molecular formula C16H22ClFN2O and a molecular weight of 312.82 g/mol. Its IUPAC name is 4-[1-[(2-chloro-6-fluorophenyl)methyl]piperidin-4-yl]morpholine.
| Compound Name | 4-[1-[(2-chloro-6-fluorophenyl)methyl]piperidin-4-yl]morpholine |
|---|---|
| PubChem CID | 171691361 |
| Molecular Formula | C16H22ClFN2O |
| Molecular Weight | 312.82 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 4-[1-[(2-chloro-6-fluorophenyl)methyl]piperidin-4-yl]morpholine |
| SMILES | Fc1cccc(Cl)c1CN1CCC(N2CCOCC2)CC1 |
| InChI | InChI=1S/C16H22ClFN2O/c17-15-2-1-3-16(18)14(15)12-19-6-4-13(5-7-19)20-8-10-21-11-9-20/h1-3,13H,4-12H2 |
| InChIKey | SAHIFAZSNGOKHN-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.82 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |