C19H29ClFN3O2 — CID 16677335
(3R,4R)-1-[(2-chloro-6-fluorophenyl)methyl]-4-(3-morpholin-4-ylpropylamino)piperidin-3-ol (PubChem CID 16677335) has the molecular formula C19H29ClFN3O2 and a molecular weight of 385.91 g/mol. Its IUPAC name is (3R,4R)-1-[(2-chloro-6-fluorophenyl)methyl]-4-(3-morpholin-4-ylpropylamino)piperidin-3-ol.
| Compound Name | (3R,4R)-1-[(2-chloro-6-fluorophenyl)methyl]-4-(3-morpholin-4-ylpropylamino)piperidin-3-ol |
|---|---|
| PubChem CID | 16677335 |
| Molecular Formula | C19H29ClFN3O2 |
| Molecular Weight | 385.91 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | (3R,4R)-1-[(2-chloro-6-fluorophenyl)methyl]-4-(3-morpholin-4-ylpropylamino)piperidin-3-ol |
| SMILES | O[C@@H]1CN(Cc2c(F)cccc2Cl)CC[C@H]1NCCCN1CCOCC1 |
| InChI | InChI=1S/C19H29ClFN3O2/c20-16-3-1-4-17(21)15(16)13-24-8-5-18(19(25)14-24)22-6-2-7-23-9-11-26-12-10-23/h1,3-4,18-19,22,25H,2,5-14H2/t18-,19-/m1/s1 |
| InChIKey | IWBXDTJWULVIDI-RTBURBONSA-N |
| XLogP | 1.73 |
| TPSA | 47.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.91 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|