C12H17Cl2FN2 — CID 119905861
1-[(2-chloro-6-fluorophenyl)methyl]-N-methylpyrrolidin-3-amine;hydrochloride (PubChem CID 119905861) has the molecular formula C12H17Cl2FN2 and a molecular weight of 279.19 g/mol. Its IUPAC name is 1-[(2-chloro-6-fluorophenyl)methyl]-N-methylpyrrolidin-3-amine;hydrochloride.
| Compound Name | 1-[(2-chloro-6-fluorophenyl)methyl]-N-methylpyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 119905861 |
| Molecular Formula | C12H17Cl2FN2 |
| Molecular Weight | 279.19 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 1-[(2-chloro-6-fluorophenyl)methyl]-N-methylpyrrolidin-3-amine;hydrochloride |
| SMILES | CNC1CCN(Cc2c(F)cccc2Cl)C1.Cl |
| InChI | InChI=1S/C12H16ClFN2.ClH/c1-15-9-5-6-16(7-9)8-10-11(13)3-2-4-12(10)14;/h2-4,9,15H,5-8H2,1H3;1H |
| InChIKey | KKKTZJLSIMWVNP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.19 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |