C12H16F2N2 — CID 115300011
1-[(2,6-difluorophenyl)methyl]-N-methylpyrrolidin-3-amine (PubChem CID 115300011) has the molecular formula C12H16F2N2 and a molecular weight of 226.27 g/mol. Its IUPAC name is 1-[(2,6-difluorophenyl)methyl]-N-methylpyrrolidin-3-amine.
| Compound Name | 1-[(2,6-difluorophenyl)methyl]-N-methylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 115300011 |
| Molecular Formula | C12H16F2N2 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 1-[(2,6-difluorophenyl)methyl]-N-methylpyrrolidin-3-amine |
| SMILES | CNC1CCN(Cc2c(F)cccc2F)C1 |
| InChI | InChI=1S/C12H16F2N2/c1-15-9-5-6-16(7-9)8-10-11(13)3-2-4-12(10)14/h2-4,9,15H,5-8H2,1H3 |
| InChIKey | XWZZBCVXFLOYKK-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |