C14H21F2N3O2S — CID 95322592
(3R)-1-[(2,6-difluorophenyl)methyl]-3-(dimethylsulfamoylamino)piperidine (PubChem CID 95322592) has the molecular formula C14H21F2N3O2S and a molecular weight of 333.40 g/mol. Its IUPAC name is (3R)-1-[(2,6-difluorophenyl)methyl]-3-(dimethylsulfamoylamino)piperidine.
| Compound Name | (3R)-1-[(2,6-difluorophenyl)methyl]-3-(dimethylsulfamoylamino)piperidine |
|---|---|
| PubChem CID | 95322592 |
| Molecular Formula | C14H21F2N3O2S |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | (3R)-1-[(2,6-difluorophenyl)methyl]-3-(dimethylsulfamoylamino)piperidine |
| SMILES | CN(C)S(=O)(=O)N[C@@H]1CCCN(Cc2c(F)cccc2F)C1 |
| InChI | InChI=1S/C14H21F2N3O2S/c1-18(2)22(20,21)17-11-5-4-8-19(9-11)10-12-13(15)6-3-7-14(12)16/h3,6-7,11,17H,4-5,8-10H2,1-2H3/t11-/m1/s1 |
| InChIKey | BKIXXFWHDWTDKO-LLVKDONJSA-N |
| XLogP | 1.33 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |