C13H16ClFN2O — CID 74237935
1-[(2-chloro-6-fluorophenyl)methyl]-N-methylpyrrolidine-3-carboxamide (PubChem CID 74237935) has the molecular formula C13H16ClFN2O and a molecular weight of 270.73 g/mol. Its IUPAC name is 1-[(2-chloro-6-fluorophenyl)methyl]-N-methylpyrrolidine-3-carboxamide.
| Compound Name | 1-[(2-chloro-6-fluorophenyl)methyl]-N-methylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 74237935 |
| Molecular Formula | C13H16ClFN2O |
| Molecular Weight | 270.73 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 1-[(2-chloro-6-fluorophenyl)methyl]-N-methylpyrrolidine-3-carboxamide |
| SMILES | CNC(=O)C1CCN(Cc2c(F)cccc2Cl)C1 |
| InChI | InChI=1S/C13H16ClFN2O/c1-16-13(18)9-5-6-17(7-9)8-10-11(14)3-2-4-12(10)15/h2-4,9H,5-8H2,1H3,(H,16,18) |
| InChIKey | ZGKQEMRXRPPFKL-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.73 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |