C15H22ClFN2 — CID 71174684
1-butyl-4-[(2-chloro-6-fluorophenyl)methyl]piperazine (PubChem CID 71174684) has the molecular formula C15H22ClFN2 and a molecular weight of 284.81 g/mol. Its IUPAC name is 1-butyl-4-[(2-chloro-6-fluorophenyl)methyl]piperazine.
| Compound Name | 1-butyl-4-[(2-chloro-6-fluorophenyl)methyl]piperazine |
|---|---|
| PubChem CID | 71174684 |
| Molecular Formula | C15H22ClFN2 |
| Molecular Weight | 284.81 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 1-butyl-4-[(2-chloro-6-fluorophenyl)methyl]piperazine |
| SMILES | CCCCN1CCN(Cc2c(F)cccc2Cl)CC1 |
| InChI | InChI=1S/C15H22ClFN2/c1-2-3-7-18-8-10-19(11-9-18)12-13-14(16)5-4-6-15(13)17/h4-6H,2-3,7-12H2,1H3 |
| InChIKey | MKIQXNRCOQBLAJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.81 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |