C14H20Cl2N2 — CID 58358826
1-butyl-4-(2,3-dichlorophenyl)piperazine (PubChem CID 58358826) has the molecular formula C14H20Cl2N2 and a molecular weight of 287.23 g/mol. Its IUPAC name is 1-butyl-4-(2,3-dichlorophenyl)piperazine.
| Compound Name | 1-butyl-4-(2,3-dichlorophenyl)piperazine |
|---|---|
| PubChem CID | 58358826 |
| Molecular Formula | C14H20Cl2N2 |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 1-butyl-4-(2,3-dichlorophenyl)piperazine |
| SMILES | CCCCN1CCN(c2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C14H20Cl2N2/c1-2-3-7-17-8-10-18(11-9-17)13-6-4-5-12(15)14(13)16/h4-6H,2-3,7-11H2,1H3 |
| InChIKey | GXSJLZZVCQCUTH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |