C17H25Cl2N3 — CID 68811205
1-(2,3-dichlorophenyl)-4-(2-piperidin-4-ylethyl)piperazine (PubChem CID 68811205) has the molecular formula C17H25Cl2N3 and a molecular weight of 342.31 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-4-(2-piperidin-4-ylethyl)piperazine.
| Compound Name | 1-(2,3-dichlorophenyl)-4-(2-piperidin-4-ylethyl)piperazine |
|---|---|
| PubChem CID | 68811205 |
| Molecular Formula | C17H25Cl2N3 |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-4-(2-piperidin-4-ylethyl)piperazine |
| SMILES | Clc1cccc(N2CCN(CCC3CCNCC3)CC2)c1Cl |
| InChI | InChI=1S/C17H25Cl2N3/c18-15-2-1-3-16(17(15)19)22-12-10-21(11-13-22)9-6-14-4-7-20-8-5-14/h1-3,14,20H,4-13H2 |
| InChIKey | PLCMNTIYNKRHRJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |