C24H35Cl2N3O — CID 175084902
1-[4-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]piperidin-1-yl]cyclohexane-1-carbaldehyde (PubChem CID 175084902) has the molecular formula C24H35Cl2N3O and a molecular weight of 452.47 g/mol. Its IUPAC name is 1-[4-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]piperidin-1-yl]cyclohexane-1-carbaldehyde.
| Compound Name | 1-[4-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]piperidin-1-yl]cyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 175084902 |
| Molecular Formula | C24H35Cl2N3O |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | 1-[4-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]piperidin-1-yl]cyclohexane-1-carbaldehyde |
| SMILES | O=CC1(N2CCC(CCN3CCN(c4cccc(Cl)c4Cl)CC3)CC2)CCCCC1 |
| InChI | InChI=1S/C24H35Cl2N3O/c25-21-5-4-6-22(23(21)26)28-17-15-27(16-18-28)12-7-20-8-13-29(14-9-20)24(19-30)10-2-1-3-11-24/h4-6,19-20H,1-3,7-18H2 |
| InChIKey | AIMQLHJQWCBOIQ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|