C22H33Cl3N4O3 — CID 87209071
[[4-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]cyclohexyl]-(dimethylcarbamoyl)amino] formate;hydrochloride (PubChem CID 87209071) has the molecular formula C22H33Cl3N4O3 and a molecular weight of 507.89 g/mol. Its IUPAC name is [[4-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]cyclohexyl]-(dimethylcarbamoyl)amino] formate;hydrochloride.
| Compound Name | [[4-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]cyclohexyl]-(dimethylcarbamoyl)amino] formate;hydrochloride |
|---|---|
| PubChem CID | 87209071 |
| Molecular Formula | C22H33Cl3N4O3 |
| Molecular Weight | 507.89 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | [[4-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]cyclohexyl]-(dimethylcarbamoyl)amino] formate;hydrochloride |
| SMILES | CN(C)C(=O)N(OC=O)C1CCC(CCN2CCN(c3cccc(Cl)c3Cl)CC2)CC1.Cl |
| InChI | InChI=1S/C22H32Cl2N4O3.ClH/c1-25(2)22(30)28(31-16-29)18-8-6-17(7-9-18)10-11-26-12-14-27(15-13-26)20-5-3-4-19(23)21(20)24;/h3-5,16-18H,6-15H2,1-2H3;1H |
| InChIKey | PEUFCTSJAJHRHE-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 56.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.89 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|