C21H33Cl2N4O+ — CID 139031870
[[[4-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]cyclohexyl]amino]-hydroxymethylidene]-dimethylazanium (PubChem CID 139031870) has the molecular formula C21H33Cl2N4O+ and a molecular weight of 428.43 g/mol. Its IUPAC name is [[[4-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]cyclohexyl]amino]-hydroxymethylidene]-dimethylazanium.
| Compound Name | [[[4-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]cyclohexyl]amino]-hydroxymethylidene]-dimethylazanium |
|---|---|
| PubChem CID | 139031870 |
| Molecular Formula | C21H33Cl2N4O+ |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | [[[4-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]cyclohexyl]amino]-hydroxymethylidene]-dimethylazanium |
| SMILES | C[N+](C)=C(O)NC1CCC(CCN2CCN(c3cccc(Cl)c3Cl)CC2)CC1 |
| InChI | InChI=1S/C21H32Cl2N4O/c1-25(2)21(28)24-17-8-6-16(7-9-17)10-11-26-12-14-27(15-13-26)19-5-3-4-18(22)20(19)23/h3-5,16-17H,6-15H2,1-2H3,(H,24,28)/p+1 |
| InChIKey | KPWSJANDNDDRMB-UHFFFAOYSA-O |
| XLogP | 3.84 |
| TPSA | 41.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|