C19H28Cl2N4O — CID 11200383
[4-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]cyclohexyl]urea (PubChem CID 11200383) has the molecular formula C19H28Cl2N4O and a molecular weight of 399.37 g/mol. Its IUPAC name is [4-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]cyclohexyl]urea.
| Compound Name | [4-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]cyclohexyl]urea |
|---|---|
| PubChem CID | 11200383 |
| Molecular Formula | C19H28Cl2N4O |
| Molecular Weight | 399.37 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | [4-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]cyclohexyl]urea |
| SMILES | NC(=O)NC1CCC(CCN2CCN(c3cccc(Cl)c3Cl)CC2)CC1 |
| InChI | InChI=1S/C19H28Cl2N4O/c20-16-2-1-3-17(18(16)21)25-12-10-24(11-13-25)9-8-14-4-6-15(7-5-14)23-19(22)26/h1-3,14-15H,4-13H2,(H3,22,23,26) |
| InChIKey | UMTWXZNVNBBFLC-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |