C17H23Cl2N3O — CID 155034838
N-[3-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]cyclobutyl]formamide (PubChem CID 155034838) has the molecular formula C17H23Cl2N3O and a molecular weight of 356.30 g/mol. Its IUPAC name is N-[3-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]cyclobutyl]formamide.
| Compound Name | N-[3-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]cyclobutyl]formamide |
|---|---|
| PubChem CID | 155034838 |
| Molecular Formula | C17H23Cl2N3O |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | N-[3-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]cyclobutyl]formamide |
| SMILES | O=CNC1CC(CCN2CCN(c3cccc(Cl)c3Cl)CC2)C1 |
| InChI | InChI=1S/C17H23Cl2N3O/c18-15-2-1-3-16(17(15)19)22-8-6-21(7-9-22)5-4-13-10-14(11-13)20-12-23/h1-3,12-14H,4-11H2,(H,20,23) |
| InChIKey | YZMVHUHKDQMFJK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|