C22H32Cl2N4O3S — CID 87522709
ethyl N-[[4-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]cyclohexyl]-sulfanylcarbamoyl]carbamate (PubChem CID 87522709) has the molecular formula C22H32Cl2N4O3S and a molecular weight of 503.50 g/mol. Its IUPAC name is ethyl N-[[4-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]cyclohexyl]-sulfanylcarbamoyl]carbamate.
| Compound Name | ethyl N-[[4-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]cyclohexyl]-sulfanylcarbamoyl]carbamate |
|---|---|
| PubChem CID | 87522709 |
| Molecular Formula | C22H32Cl2N4O3S |
| Molecular Weight | 503.50 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | ethyl N-[[4-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]cyclohexyl]-sulfanylcarbamoyl]carbamate |
| SMILES | CCOC(=O)NC(=O)N(S)C1CCC(CCN2CCN(c3cccc(Cl)c3Cl)CC2)CC1 |
| InChI | InChI=1S/C22H32Cl2N4O3S/c1-2-31-22(30)25-21(29)28(32)17-8-6-16(7-9-17)10-11-26-12-14-27(15-13-26)19-5-3-4-18(23)20(19)24/h3-5,16-17,32H,2,6-15H2,1H3,(H,25,29,30) |
| InChIKey | WUGIOYUKDCJINQ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.50 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|