C19H26Cl2N2 — CID 164673257
1-[(E)-3-cyclohexylprop-2-enyl]-4-(2,3-dichlorophenyl)piperazine (PubChem CID 164673257) has the molecular formula C19H26Cl2N2 and a molecular weight of 353.34 g/mol. Its IUPAC name is 1-[(E)-3-cyclohexylprop-2-enyl]-4-(2,3-dichlorophenyl)piperazine.
| Compound Name | 1-[(E)-3-cyclohexylprop-2-enyl]-4-(2,3-dichlorophenyl)piperazine |
|---|---|
| PubChem CID | 164673257 |
| Molecular Formula | C19H26Cl2N2 |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 1-[(E)-3-cyclohexylprop-2-enyl]-4-(2,3-dichlorophenyl)piperazine |
| SMILES | Clc1cccc(N2CCN(C/C=C/C3CCCCC3)CC2)c1Cl |
| InChI | InChI=1S/C19H26Cl2N2/c20-17-9-4-10-18(19(17)21)23-14-12-22(13-15-23)11-5-8-16-6-2-1-3-7-16/h4-5,8-10,16H,1-3,6-7,11-15H2/b8-5+ |
| InChIKey | NJBFPSADHVORMG-VMPITWQZSA-N |
| XLogP | 5.25 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|