C23H23Cl2N3O2 — CID 11775114
7-[(Z)-4-[4-(2,3-dichlorophenyl)piperazin-1-yl]but-2-enoxy]-1H-quinolin-2-one (PubChem CID 11775114) has the molecular formula C23H23Cl2N3O2 and a molecular weight of 444.36 g/mol. Its IUPAC name is 7-[(Z)-4-[4-(2,3-dichlorophenyl)piperazin-1-yl]but-2-enoxy]-1H-quinolin-2-one.
| Compound Name | 7-[(Z)-4-[4-(2,3-dichlorophenyl)piperazin-1-yl]but-2-enoxy]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 11775114 |
| Molecular Formula | C23H23Cl2N3O2 |
| Molecular Weight | 444.36 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | 7-[(Z)-4-[4-(2,3-dichlorophenyl)piperazin-1-yl]but-2-enoxy]-1H-quinolin-2-one |
| SMILES | O=c1ccc2ccc(OC/C=C\CN3CCN(c4cccc(Cl)c4Cl)CC3)cc2[nH]1 |
| InChI | InChI=1S/C23H23Cl2N3O2/c24-19-4-3-5-21(23(19)25)28-13-11-27(12-14-28)10-1-2-15-30-18-8-6-17-7-9-22(29)26-20(17)16-18/h1-9,16H,10-15H2,(H,26,29)/b2-1- |
| InChIKey | LALVSNMPFJHVIQ-UPHRSURJSA-N |
| XLogP | 4.59 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.36 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|