C22H24Cl2N4O2 — CID 21073533
7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-1H-1,6-naphthyridin-2-one (PubChem CID 21073533) has the molecular formula C22H24Cl2N4O2 and a molecular weight of 447.37 g/mol. Its IUPAC name is 7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-1H-1,6-naphthyridin-2-one.
| Compound Name | 7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-1H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 21073533 |
| Molecular Formula | C22H24Cl2N4O2 |
| Molecular Weight | 447.37 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-1H-1,6-naphthyridin-2-one |
| SMILES | O=c1ccc2cnc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc2[nH]1 |
| InChI | InChI=1S/C22H24Cl2N4O2/c23-17-4-3-5-19(22(17)24)28-11-9-27(10-12-28)8-1-2-13-30-21-14-18-16(15-25-21)6-7-20(29)26-18/h3-7,14-15H,1-2,8-13H2,(H,26,29) |
| InChIKey | IXCOCXDWNZNCFL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.37 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|