C21H25Cl2N5 — CID 56597365
N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-1H-indazol-6-amine (PubChem CID 56597365) has the molecular formula C21H25Cl2N5 and a molecular weight of 418.37 g/mol. Its IUPAC name is N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-1H-indazol-6-amine.
| Compound Name | N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-1H-indazol-6-amine |
|---|---|
| PubChem CID | 56597365 |
| Molecular Formula | C21H25Cl2N5 |
| Molecular Weight | 418.37 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-1H-indazol-6-amine |
| SMILES | Clc1cccc(N2CCN(CCCCNc3ccc4cn[nH]c4c3)CC2)c1Cl |
| InChI | InChI=1S/C21H25Cl2N5/c22-18-4-3-5-20(21(18)23)28-12-10-27(11-13-28)9-2-1-8-24-17-7-6-16-15-25-26-19(16)14-17/h3-7,14-15,24H,1-2,8-13H2,(H,25,26) |
| InChIKey | MUZUJTOLDGGAMM-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 47.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.37 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|