C23H26Cl2N4O — CID 10873956
N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-1H-indole-3-carboxamide (PubChem CID 10873956) has the molecular formula C23H26Cl2N4O and a molecular weight of 445.39 g/mol. Its IUPAC name is N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-1H-indole-3-carboxamide.
| Compound Name | N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 10873956 |
| Molecular Formula | C23H26Cl2N4O |
| Molecular Weight | 445.39 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-1H-indole-3-carboxamide |
| SMILES | O=C(NCCCCN1CCN(c2cccc(Cl)c2Cl)CC1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C23H26Cl2N4O/c24-19-7-5-9-21(22(19)25)29-14-12-28(13-15-29)11-4-3-10-26-23(30)18-16-27-20-8-2-1-6-17(18)20/h1-2,5-9,16,27H,3-4,10-15H2,(H,26,30) |
| InChIKey | SUMKBFVXRDCDIJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.39 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|