C24H26Cl2FN3O2 — CID 59178312
N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-6-fluoro-2H-chromene-3-carboxamide (PubChem CID 59178312) has the molecular formula C24H26Cl2FN3O2 and a molecular weight of 478.40 g/mol. Its IUPAC name is N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-6-fluoro-2H-chromene-3-carboxamide.
| Compound Name | N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-6-fluoro-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 59178312 |
| Molecular Formula | C24H26Cl2FN3O2 |
| Molecular Weight | 478.40 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-6-fluoro-2H-chromene-3-carboxamide |
| SMILES | O=C(NCCCCN1CCN(c2cccc(Cl)c2Cl)CC1)C1=Cc2cc(F)ccc2OC1 |
| InChI | InChI=1S/C24H26Cl2FN3O2/c25-20-4-3-5-21(23(20)26)30-12-10-29(11-13-30)9-2-1-8-28-24(31)18-14-17-15-19(27)6-7-22(17)32-16-18/h3-7,14-15H,1-2,8-13,16H2,(H,28,31) |
| InChIKey | PAJSMQZKYIXTGJ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.40 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|