C29H30Cl3N3O — CID 21202834
N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]anthracene-2-carboxamide;hydrochloride (PubChem CID 21202834) has the molecular formula C29H30Cl3N3O and a molecular weight of 542.94 g/mol. Its IUPAC name is N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]anthracene-2-carboxamide;hydrochloride.
| Compound Name | N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]anthracene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 21202834 |
| Molecular Formula | C29H30Cl3N3O |
| Molecular Weight | 542.94 g/mol |
| Exact Mass | 541.15 |
| IUPAC Name | N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]anthracene-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCCCCN1CCN(c2cccc(Cl)c2Cl)CC1)c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C29H29Cl2N3O.ClH/c30-26-8-5-9-27(28(26)31)34-16-14-33(15-17-34)13-4-3-12-32-29(35)24-11-10-23-18-21-6-1-2-7-22(21)19-25(23)20-24;/h1-2,5-11,18-20H,3-4,12-17H2,(H,32,35);1H |
| InChIKey | WSNIGFJVUMUZEM-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.94 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|