C29H38Cl2N4O — CID 44529549
3-cyclobutyl-N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-1,2,4,5-tetrahydro-3-benzazepine-7-carboxamide (PubChem CID 44529549) has the molecular formula C29H38Cl2N4O and a molecular weight of 529.56 g/mol. Its IUPAC name is 3-cyclobutyl-N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-1,2,4,5-tetrahydro-3-benzazepine-7-carboxamide.
| Compound Name | 3-cyclobutyl-N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-1,2,4,5-tetrahydro-3-benzazepine-7-carboxamide |
|---|---|
| PubChem CID | 44529549 |
| Molecular Formula | C29H38Cl2N4O |
| Molecular Weight | 529.56 g/mol |
| Exact Mass | 528.24 |
| IUPAC Name | 3-cyclobutyl-N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-1,2,4,5-tetrahydro-3-benzazepine-7-carboxamide |
| SMILES | O=C(NCCCCN1CCN(c2cccc(Cl)c2Cl)CC1)c1ccc2c(c1)CCN(C1CCC1)CC2 |
| InChI | InChI=1S/C29H38Cl2N4O/c30-26-7-4-8-27(28(26)31)35-19-17-33(18-20-35)14-2-1-13-32-29(36)24-10-9-22-11-15-34(25-5-3-6-25)16-12-23(22)21-24/h4,7-10,21,25H,1-3,5-6,11-20H2,(H,32,36) |
| InChIKey | QUZADQLTRKINEQ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.56 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|