C22H29Cl2N5O — CID 143226888
N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-5-[(Z)-ethylideneamino]-4-methyl-1H-pyrrole-2-carboxamide (PubChem CID 143226888) has the molecular formula C22H29Cl2N5O and a molecular weight of 450.41 g/mol. Its IUPAC name is N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-5-[(Z)-ethylideneamino]-4-methyl-1H-pyrrole-2-carboxamide.
| Compound Name | N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-5-[(Z)-ethylideneamino]-4-methyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 143226888 |
| Molecular Formula | C22H29Cl2N5O |
| Molecular Weight | 450.41 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-5-[(Z)-ethylideneamino]-4-methyl-1H-pyrrole-2-carboxamide |
| SMILES | C/C=N\c1[nH]c(C(=O)NCCCCN2CCN(c3cccc(Cl)c3Cl)CC2)cc1C |
| InChI | InChI=1S/C22H29Cl2N5O/c1-3-25-21-16(2)15-18(27-21)22(30)26-9-4-5-10-28-11-13-29(14-12-28)19-8-6-7-17(23)20(19)24/h3,6-8,15,27H,4-5,9-14H2,1-2H3,(H,26,30)/b25-3- |
| InChIKey | STPDONBULCASIB-GYEZCXOLSA-N |
| XLogP | 4.68 |
| TPSA | 63.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.41 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|