C27H32Cl2N4O — CID 58358816
N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-2,4-dimethyl-5-phenyl-1H-pyrrole-3-carboxamide (PubChem CID 58358816) has the molecular formula C27H32Cl2N4O and a molecular weight of 499.49 g/mol. Its IUPAC name is N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-2,4-dimethyl-5-phenyl-1H-pyrrole-3-carboxamide.
| Compound Name | N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-2,4-dimethyl-5-phenyl-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 58358816 |
| Molecular Formula | C27H32Cl2N4O |
| Molecular Weight | 499.49 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-2,4-dimethyl-5-phenyl-1H-pyrrole-3-carboxamide |
| SMILES | Cc1[nH]c(-c2ccccc2)c(C)c1C(=O)NCCCCN1CCN(c2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C27H32Cl2N4O/c1-19-24(20(2)31-26(19)21-9-4-3-5-10-21)27(34)30-13-6-7-14-32-15-17-33(18-16-32)23-12-8-11-22(28)25(23)29/h3-5,8-12,31H,6-7,13-18H2,1-2H3,(H,30,34) |
| InChIKey | LTHPYSRWZUWTTA-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.49 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|