C31H31Cl2FN4O — CID 45278886
N-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propyl]-1-(4-fluorophenyl)-2-methyl-5-phenylpyrrole-3-carboxamide (PubChem CID 45278886) has the molecular formula C31H31Cl2FN4O and a molecular weight of 565.52 g/mol. Its IUPAC name is N-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propyl]-1-(4-fluorophenyl)-2-methyl-5-phenylpyrrole-3-carboxamide.
| Compound Name | N-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propyl]-1-(4-fluorophenyl)-2-methyl-5-phenylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 45278886 |
| Molecular Formula | C31H31Cl2FN4O |
| Molecular Weight | 565.52 g/mol |
| Exact Mass | 564.19 |
| IUPAC Name | N-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propyl]-1-(4-fluorophenyl)-2-methyl-5-phenylpyrrole-3-carboxamide |
| SMILES | Cc1c(C(=O)NCCCN2CCN(c3cccc(Cl)c3Cl)CC2)cc(-c2ccccc2)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C31H31Cl2FN4O/c1-22-26(21-29(23-7-3-2-4-8-23)38(22)25-13-11-24(34)12-14-25)31(39)35-15-6-16-36-17-19-37(20-18-36)28-10-5-9-27(32)30(28)33/h2-5,7-14,21H,6,15-20H2,1H3,(H,35,39) |
| InChIKey | HUDVPJBZHXPMCT-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.52 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|