C25H28Cl2N4O — CID 58358858
N-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]-2,5-dimethyl-1-phenylpyrrole-3-carboxamide (PubChem CID 58358858) has the molecular formula C25H28Cl2N4O and a molecular weight of 471.43 g/mol. Its IUPAC name is N-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]-2,5-dimethyl-1-phenylpyrrole-3-carboxamide.
| Compound Name | N-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]-2,5-dimethyl-1-phenylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 58358858 |
| Molecular Formula | C25H28Cl2N4O |
| Molecular Weight | 471.43 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | N-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]-2,5-dimethyl-1-phenylpyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCCN2CCN(c3cccc(Cl)c3Cl)CC2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C25H28Cl2N4O/c1-18-17-21(19(2)31(18)20-7-4-3-5-8-20)25(32)28-11-12-29-13-15-30(16-14-29)23-10-6-9-22(26)24(23)27/h3-10,17H,11-16H2,1-2H3,(H,28,32) |
| InChIKey | VVBLZVZEZSZXBR-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.43 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|