C19H25N3O2 — CID 55348355
2,5-dimethyl-N-(2-morpholin-4-ylethyl)-1-phenylpyrrole-3-carboxamide (PubChem CID 55348355) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 2,5-dimethyl-N-(2-morpholin-4-ylethyl)-1-phenylpyrrole-3-carboxamide.
| Compound Name | 2,5-dimethyl-N-(2-morpholin-4-ylethyl)-1-phenylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 55348355 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 2,5-dimethyl-N-(2-morpholin-4-ylethyl)-1-phenylpyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCCN2CCOCC2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C19H25N3O2/c1-15-14-18(16(2)22(15)17-6-4-3-5-7-17)19(23)20-8-9-21-10-12-24-13-11-21/h3-7,14H,8-13H2,1-2H3,(H,20,23) |
| InChIKey | DSYCQZSZJPPWSI-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|