C18H22N2O3 — CID 119234907
5-[(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)amino]pentanoic acid (PubChem CID 119234907) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is 5-[(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)amino]pentanoic acid.
| Compound Name | 5-[(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 119234907 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 5-[(2,5-dimethyl-1-phenylpyrrole-3-carbonyl)amino]pentanoic acid |
| SMILES | Cc1cc(C(=O)NCCCCC(=O)O)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C18H22N2O3/c1-13-12-16(18(23)19-11-7-6-10-17(21)22)14(2)20(13)15-8-4-3-5-9-15/h3-5,8-9,12H,6-7,10-11H2,1-2H3,(H,19,23)(H,21,22) |
| InChIKey | USCLMRRYRYYWNI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|