C18H21FN2O3 — CID 119234411
5-[[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]pentanoic acid (PubChem CID 119234411) has the molecular formula C18H21FN2O3 and a molecular weight of 332.38 g/mol. Its IUPAC name is 5-[[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]pentanoic acid.
| Compound Name | 5-[[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 119234411 |
| Molecular Formula | C18H21FN2O3 |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 5-[[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]pentanoic acid |
| SMILES | Cc1cc(C(=O)NCCCCC(=O)O)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C18H21FN2O3/c1-12-11-16(18(24)20-10-4-3-5-17(22)23)13(2)21(12)15-8-6-14(19)7-9-15/h6-9,11H,3-5,10H2,1-2H3,(H,20,24)(H,22,23) |
| InChIKey | AUYYLOQCCAYZDQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|