C20H28ClFN4O — CID 119393216
1-(4-fluorophenyl)-2,5-dimethyl-N-(3-piperazin-1-ylpropyl)pyrrole-3-carboxamide;hydrochloride (PubChem CID 119393216) has the molecular formula C20H28ClFN4O and a molecular weight of 394.92 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2,5-dimethyl-N-(3-piperazin-1-ylpropyl)pyrrole-3-carboxamide;hydrochloride.
| Compound Name | 1-(4-fluorophenyl)-2,5-dimethyl-N-(3-piperazin-1-ylpropyl)pyrrole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119393216 |
| Molecular Formula | C20H28ClFN4O |
| Molecular Weight | 394.92 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 1-(4-fluorophenyl)-2,5-dimethyl-N-(3-piperazin-1-ylpropyl)pyrrole-3-carboxamide;hydrochloride |
| SMILES | Cc1cc(C(=O)NCCCN2CCNCC2)c(C)n1-c1ccc(F)cc1.Cl |
| InChI | InChI=1S/C20H27FN4O.ClH/c1-15-14-19(16(2)25(15)18-6-4-17(21)5-7-18)20(26)23-8-3-11-24-12-9-22-10-13-24;/h4-7,14,22H,3,8-13H2,1-2H3,(H,23,26);1H |
| InChIKey | LYXNAUDDCXMPIM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 49.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.92 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|