C17H22FN5O — CID 119446091
1-(4-fluorophenyl)-5-methyl-N-(2-piperazin-1-ylethyl)pyrazole-4-carboxamide (PubChem CID 119446091) has the molecular formula C17H22FN5O and a molecular weight of 331.39 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-5-methyl-N-(2-piperazin-1-ylethyl)pyrazole-4-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-5-methyl-N-(2-piperazin-1-ylethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 119446091 |
| Molecular Formula | C17H22FN5O |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 1-(4-fluorophenyl)-5-methyl-N-(2-piperazin-1-ylethyl)pyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NCCN2CCNCC2)cnn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C17H22FN5O/c1-13-16(12-21-23(13)15-4-2-14(18)3-5-15)17(24)20-8-11-22-9-6-19-7-10-22/h2-5,12,19H,6-11H2,1H3,(H,20,24) |
| InChIKey | DYYUOVNYXKFUFW-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |