C18H25Cl2FN4O — CID 119392326
7-fluoro-2-methyl-N-(3-piperazin-1-ylpropyl)quinoline-3-carboxamide;dihydrochloride (PubChem CID 119392326) has the molecular formula C18H25Cl2FN4O and a molecular weight of 403.33 g/mol. Its IUPAC name is 7-fluoro-2-methyl-N-(3-piperazin-1-ylpropyl)quinoline-3-carboxamide;dihydrochloride.
| Compound Name | 7-fluoro-2-methyl-N-(3-piperazin-1-ylpropyl)quinoline-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119392326 |
| Molecular Formula | C18H25Cl2FN4O |
| Molecular Weight | 403.33 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 7-fluoro-2-methyl-N-(3-piperazin-1-ylpropyl)quinoline-3-carboxamide;dihydrochloride |
| SMILES | Cc1nc2cc(F)ccc2cc1C(=O)NCCCN1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C18H23FN4O.2ClH/c1-13-16(11-14-3-4-15(19)12-17(14)22-13)18(24)21-5-2-8-23-9-6-20-7-10-23;;/h3-4,11-12,20H,2,5-10H2,1H3,(H,21,24);2*1H |
| InChIKey | YVHAJQZNZPAUQE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|