C19H27FN6O — CID 119392110
1-(3-fluorophenyl)-N-(3-piperazin-1-ylpropyl)-5-propan-2-yl-1,2,4-triazole-3-carboxamide (PubChem CID 119392110) has the molecular formula C19H27FN6O and a molecular weight of 374.46 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-N-(3-piperazin-1-ylpropyl)-5-propan-2-yl-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-(3-fluorophenyl)-N-(3-piperazin-1-ylpropyl)-5-propan-2-yl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 119392110 |
| Molecular Formula | C19H27FN6O |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 1-(3-fluorophenyl)-N-(3-piperazin-1-ylpropyl)-5-propan-2-yl-1,2,4-triazole-3-carboxamide |
| SMILES | CC(C)c1nc(C(=O)NCCCN2CCNCC2)nn1-c1cccc(F)c1 |
| InChI | InChI=1S/C19H27FN6O/c1-14(2)18-23-17(24-26(18)16-6-3-5-15(20)13-16)19(27)22-7-4-10-25-11-8-21-9-12-25/h3,5-6,13-14,21H,4,7-12H2,1-2H3,(H,22,27) |
| InChIKey | GZWKUHJWWWFUQO-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|