C17H23FN6O — CID 119392183
1-[(3-fluorophenyl)methyl]-N-(3-piperazin-1-ylpropyl)triazole-4-carboxamide (PubChem CID 119392183) has the molecular formula C17H23FN6O and a molecular weight of 346.41 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-N-(3-piperazin-1-ylpropyl)triazole-4-carboxamide.
| Compound Name | 1-[(3-fluorophenyl)methyl]-N-(3-piperazin-1-ylpropyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 119392183 |
| Molecular Formula | C17H23FN6O |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-N-(3-piperazin-1-ylpropyl)triazole-4-carboxamide |
| SMILES | O=C(NCCCN1CCNCC1)c1cn(Cc2cccc(F)c2)nn1 |
| InChI | InChI=1S/C17H23FN6O/c18-15-4-1-3-14(11-15)12-24-13-16(21-22-24)17(25)20-5-2-8-23-9-6-19-7-10-23/h1,3-4,11,13,19H,2,5-10,12H2,(H,20,25) |
| InChIKey | XJZHHFVLJAOJQN-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|