C15H29ClN6O — CID 119391025
1-(3-methylbutyl)-N-(3-piperazin-1-ylpropyl)triazole-4-carboxamide;hydrochloride (PubChem CID 119391025) has the molecular formula C15H29ClN6O and a molecular weight of 344.89 g/mol. Its IUPAC name is 1-(3-methylbutyl)-N-(3-piperazin-1-ylpropyl)triazole-4-carboxamide;hydrochloride.
| Compound Name | 1-(3-methylbutyl)-N-(3-piperazin-1-ylpropyl)triazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119391025 |
| Molecular Formula | C15H29ClN6O |
| Molecular Weight | 344.89 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 1-(3-methylbutyl)-N-(3-piperazin-1-ylpropyl)triazole-4-carboxamide;hydrochloride |
| SMILES | CC(C)CCn1cc(C(=O)NCCCN2CCNCC2)nn1.Cl |
| InChI | InChI=1S/C15H28N6O.ClH/c1-13(2)4-9-21-12-14(18-19-21)15(22)17-5-3-8-20-10-6-16-7-11-20;/h12-13,16H,3-11H2,1-2H3,(H,17,22);1H |
| InChIKey | WOORJDMHGPGNJX-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.89 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|