C10H17N5OS — CID 65216494
N-(3-piperazin-1-ylpropyl)thiadiazole-4-carboxamide (PubChem CID 65216494) has the molecular formula C10H17N5OS and a molecular weight of 255.35 g/mol. Its IUPAC name is N-(3-piperazin-1-ylpropyl)thiadiazole-4-carboxamide.
| Compound Name | N-(3-piperazin-1-ylpropyl)thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 65216494 |
| Molecular Formula | C10H17N5OS |
| Molecular Weight | 255.35 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | N-(3-piperazin-1-ylpropyl)thiadiazole-4-carboxamide |
| SMILES | O=C(NCCCN1CCNCC1)c1csnn1 |
| InChI | InChI=1S/C10H17N5OS/c16-10(9-8-17-14-13-9)12-2-1-5-15-6-3-11-4-7-15/h8,11H,1-7H2,(H,12,16) |
| InChIKey | VQMFTDHPJUYNSB-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.35 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|