C14H23N5O — CID 119391192
5-cyclopropyl-N-(3-piperazin-1-ylpropyl)-1H-pyrazole-3-carboxamide (PubChem CID 119391192) has the molecular formula C14H23N5O and a molecular weight of 277.37 g/mol. Its IUPAC name is 5-cyclopropyl-N-(3-piperazin-1-ylpropyl)-1H-pyrazole-3-carboxamide.
| Compound Name | 5-cyclopropyl-N-(3-piperazin-1-ylpropyl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 119391192 |
| Molecular Formula | C14H23N5O |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | 5-cyclopropyl-N-(3-piperazin-1-ylpropyl)-1H-pyrazole-3-carboxamide |
| SMILES | O=C(NCCCN1CCNCC1)c1cc(C2CC2)[nH]n1 |
| InChI | InChI=1S/C14H23N5O/c20-14(13-10-12(17-18-13)11-2-3-11)16-4-1-7-19-8-5-15-6-9-19/h10-11,15H,1-9H2,(H,16,20)(H,17,18) |
| InChIKey | SRUZSIBNJRJOKQ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|